C12H21NS — CID 89074128
(4Z,9Z)-6-methylidene-10-methylsulfanyldeca-4,9-dien-3-amine (PubChem CID 89074128) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (4Z,9Z)-6-methylidene-10-methylsulfanyldeca-4,9-dien-3-amine.
| Compound Name | (4Z,9Z)-6-methylidene-10-methylsulfanyldeca-4,9-dien-3-amine |
|---|---|
| PubChem CID | 89074128 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (4Z,9Z)-6-methylidene-10-methylsulfanyldeca-4,9-dien-3-amine |
| SMILES | C=C(/C=C\C(N)CC)CC/C=C\SC |
| InChI | InChI=1S/C12H21NS/c1-4-12(13)9-8-11(2)7-5-6-10-14-3/h6,8-10,12H,2,4-5,7,13H2,1,3H3/b9-8-,10-6- |
| InChIKey | DBJNOQWLQOJHNL-BLQKWXTKSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|