C7H10F3N — CID 89074179
(5E)-2,4,6-trifluorohepta-1,5-dien-3-amine (PubChem CID 89074179) has the molecular formula C7H10F3N and a molecular weight of 165.16 g/mol. Its IUPAC name is (5E)-2,4,6-trifluorohepta-1,5-dien-3-amine.
| Compound Name | (5E)-2,4,6-trifluorohepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89074179 |
| Molecular Formula | C7H10F3N |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (5E)-2,4,6-trifluorohepta-1,5-dien-3-amine |
| SMILES | C=C(F)C(N)C(F)/C=C(\C)F |
| InChI | InChI=1S/C7H10F3N/c1-4(8)3-6(10)7(11)5(2)9/h3,6-7H,2,11H2,1H3/b4-3+ |
| InChIKey | AQJDMYBBXMUOQW-ONEGZZNKSA-N |
| XLogP | 2.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |