About (1R)-4-methylcyclohexa-2,4-dien-1-amine
(1R)-4-methylcyclohexa-2,4-dien-1-amine (PubChem CID 89074190) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is (1R)-4-methylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1R)-4-methylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 89074190 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (1R)-4-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CC[C@@H](N)C=C1 |
| InChI | InChI=1S/C7H11N/c1-6-2-4-7(8)5-3-6/h2-4,7H,5,8H2,1H3/t7-/m0/s1 |
| InChIKey | VCAZSXZXLRVCCQ-ZETCQYMHSA-N |
| XLogP | 1.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-4-methylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-methylcyclohexa-2,4-dien-1-amine?
The IUPAC name of (1R)-4-methylcyclohexa-2,4-dien-1-amine (CID 89074190) is (1R)-4-methylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1R)-4-methylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1R)-4-methylcyclohexa-2,4-dien-1-amine is CC1=CC[C@@H](N)C=C1.
What is the InChIKey of (1R)-4-methylcyclohexa-2,4-dien-1-amine?
The InChIKey is VCAZSXZXLRVCCQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H11N/c1-6-2-4-7(8)5-3-6/h2-4,7H,5,8H2,1H3/t7-/m0/s1.
What are the key properties of (1R)-4-methylcyclohexa-2,4-dien-1-amine?
(1R)-4-methylcyclohexa-2,4-dien-1-amine has a molecular weight of 109.17 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-methylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89074190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).