C8H13N — CID 89074270
(1Z,3Z)-N,3-dimethylhexa-1,3,5-trien-1-amine (PubChem CID 89074270) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (1Z,3Z)-N,3-dimethylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N,3-dimethylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89074270 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (1Z,3Z)-N,3-dimethylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C/NC |
| InChI | InChI=1S/C8H13N/c1-4-5-8(2)6-7-9-3/h4-7,9H,1H2,2-3H3/b7-6-,8-5- |
| InChIKey | FVLMVQSUAYXQER-HSHIGALWSA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|