C8H12OS — CID 89074756
(3Z,5E)-5-sulfanylocta-3,5,7-trien-1-ol (PubChem CID 89074756) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is (3Z,5E)-5-sulfanylocta-3,5,7-trien-1-ol.
| Compound Name | (3Z,5E)-5-sulfanylocta-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 89074756 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (3Z,5E)-5-sulfanylocta-3,5,7-trien-1-ol |
| SMILES | C=C/C=C(S)\C=C/CCO |
| InChI | InChI=1S/C8H12OS/c1-2-5-8(10)6-3-4-7-9/h2-3,5-6,9-10H,1,4,7H2/b6-3-,8-5+ |
| InChIKey | GQZQMXSXRXVRSY-LILZIHMPSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|