About 8-methyl-8H-pyridazino[4,3-c]azepine
8-methyl-8H-pyridazino[4,3-c]azepine (PubChem CID 89075684) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 8-methyl-8H-pyridazino[4,3-c]azepine.
Molecular Properties
| Compound Name | 8-methyl-8H-pyridazino[4,3-c]azepine |
| PubChem CID | 89075684 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 8-methyl-8H-pyridazino[4,3-c]azepine |
| SMILES | CC1C=NC=c2ccnnc2=C1 |
| InChI | InChI=1S/C9H9N3/c1-7-4-9-8(6-10-5-7)2-3-11-12-9/h2-7H,1H3 |
| InChIKey | RQLWMVOIQLGCRM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-8H-pyridazino[4,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8H-pyridazino[4,3-c]azepine?
The IUPAC name of 8-methyl-8H-pyridazino[4,3-c]azepine (CID 89075684) is 8-methyl-8H-pyridazino[4,3-c]azepine.
What is the SMILES notation for 8-methyl-8H-pyridazino[4,3-c]azepine?
The canonical SMILES for 8-methyl-8H-pyridazino[4,3-c]azepine is CC1C=NC=c2ccnnc2=C1.
What is the InChIKey of 8-methyl-8H-pyridazino[4,3-c]azepine?
The InChIKey is RQLWMVOIQLGCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-7-4-9-8(6-10-5-7)2-3-11-12-9/h2-7H,1H3.
What are the key properties of 8-methyl-8H-pyridazino[4,3-c]azepine?
8-methyl-8H-pyridazino[4,3-c]azepine has a molecular weight of 159.19 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8H-pyridazino[4,3-c]azepine is sourced from PubChem (CID 89075684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).