About CID 89075733
CID 89075733 (PubChem CID 89075733) has the molecular formula C45H54BBrO4
and a molecular weight of 749.64 g/mol.
Molecular Properties
| Compound Name | CID 89075733 |
| PubChem CID | 89075733 |
| Molecular Formula | C45H54BBrO4 |
| Molecular Weight | 749.64 g/mol |
| Exact Mass | 748.33 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C1(c3cc(Br)ccc3-2)c2cc(OCC(C)CC)c(OCC(C)CC)cc2-c2cc(OCC(C)CC)c(OCC(C)CC)cc21 |
| InChI | InChI=1S/C45H54BBrO4/c1-9-27(5)23-48-41-19-35-36-20-42(49-24-28(6)10-2)44(51-26-30(8)12-4)22-40(36)45(39(35)21-43(41)50-25-29(7)11-3)37-17-31(46)13-15-33(37)34-16-14-32(47)18-38(34)45/h13-22,27-30H,9-12,23-26H2,1-8H3 |
| InChIKey | XOBPPAOVNBGUFA-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 749.64 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89075733 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89075733?
The IUPAC name of CID 89075733 (CID 89075733) is not available.
What is the SMILES notation for CID 89075733?
The canonical SMILES for CID 89075733 is [B]c1ccc2c(c1)C1(c3cc(Br)ccc3-2)c2cc(OCC(C)CC)c(OCC(C)CC)cc2-c2cc(OCC(C)CC)c(OCC(C)CC)cc21.
What is the InChIKey of CID 89075733?
The InChIKey is XOBPPAOVNBGUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H54BBrO4/c1-9-27(5)23-48-41-19-35-36-20-42(49-24-28(6)10-2)44(51-26-30(8)12-4)22-40(36)45(39(35)21-43(41)50-25-29(7)11-3)37-17-31(46)13-15-33(37)34-16-14-32(47)18-38(34)45/h13-22,27-30H,9-12,23-26H2,1-8H3.
What are the key properties of CID 89075733?
CID 89075733 has a molecular weight of 749.64 g/mol, XLogP of 11.29, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89075733 is sourced from PubChem (CID 89075733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).