C12H20N2 — CID 89075746
1,6,8-trimethyl-3,4,4a,5,6,7-hexahydropyrimido[1,6-a]azepine (PubChem CID 89075746) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1,6,8-trimethyl-3,4,4a,5,6,7-hexahydropyrimido[1,6-a]azepine.
| Compound Name | 1,6,8-trimethyl-3,4,4a,5,6,7-hexahydropyrimido[1,6-a]azepine |
|---|---|
| PubChem CID | 89075746 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,6,8-trimethyl-3,4,4a,5,6,7-hexahydropyrimido[1,6-a]azepine |
| SMILES | CC1=CN2C(C)=NCCC2CC(C)C1 |
| InChI | InChI=1S/C12H20N2/c1-9-6-10(2)8-14-11(3)13-5-4-12(14)7-9/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | BXDVCESBDQHGLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |