About 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one
3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one (PubChem CID 89075806) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one |
| PubChem CID | 89075806 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one |
| SMILES | O=C1OCCC1OC1=CCCC=C1 |
| InChI | InChI=1S/C10H12O3/c11-10-9(6-7-12-10)13-8-4-2-1-3-5-8/h2,4-5,9H,1,3,6-7H2 |
| InChIKey | LRXWVWSQUVIIJU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one (CID 89075806) is 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one is O=C1OCCC1OC1=CCCC=C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one?
The InChIKey is LRXWVWSQUVIIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c11-10-9(6-7-12-10)13-8-4-2-1-3-5-8/h2,4-5,9H,1,3,6-7H2.
What are the key properties of 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one?
3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one has a molecular weight of 180.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yloxyoxolan-2-one is sourced from PubChem (CID 89075806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).