C22H12N2O6S — CID 89075848
4-(dicyanomethylidene)-1,1-dioxo-2,6-diphenylthiopyran-3,5-dicarboxylic acid (PubChem CID 89075848) has the molecular formula C22H12N2O6S and a molecular weight of 432.41 g/mol. Its IUPAC name is 4-(dicyanomethylidene)-1,1-dioxo-2,6-diphenylthiopyran-3,5-dicarboxylic acid.
| Compound Name | 4-(dicyanomethylidene)-1,1-dioxo-2,6-diphenylthiopyran-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 89075848 |
| Molecular Formula | C22H12N2O6S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-(dicyanomethylidene)-1,1-dioxo-2,6-diphenylthiopyran-3,5-dicarboxylic acid |
| SMILES | N#CC(C#N)=C1C(C(=O)O)=C(c2ccccc2)S(=O)(=O)C(c2ccccc2)=C1C(=O)O |
| InChI | InChI=1S/C22H12N2O6S/c23-11-15(12-24)16-17(21(25)26)19(13-7-3-1-4-8-13)31(29,30)20(18(16)22(27)28)14-9-5-2-6-10-14/h1-10H,(H,25,26)(H,27,28) |
| InChIKey | XTMPJKLRBWCBFL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 156.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|