C8H12ClNO — CID 89076324
(2E,4Z,6Z)-5-amino-2-chloroocta-2,4,6-trien-4-ol (PubChem CID 89076324) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is (2E,4Z,6Z)-5-amino-2-chloroocta-2,4,6-trien-4-ol.
| Compound Name | (2E,4Z,6Z)-5-amino-2-chloroocta-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 89076324 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (2E,4Z,6Z)-5-amino-2-chloroocta-2,4,6-trien-4-ol |
| SMILES | C/C=C\C(N)=C(O)/C=C(\C)Cl |
| InChI | InChI=1S/C8H12ClNO/c1-3-4-7(10)8(11)5-6(2)9/h3-5,11H,10H2,1-2H3/b4-3-,6-5+,8-7- |
| InChIKey | UWBHQPSHIBAZKJ-UBXFYOHCSA-N |
| XLogP | 2.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|