C11H18O2 — CID 89076380
(1R,9S)-3,7,8,9-tetramethyl-2,5-dioxatricyclo[5.2.0.01,4]nonane (PubChem CID 89076380) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R,9S)-3,7,8,9-tetramethyl-2,5-dioxatricyclo[5.2.0.01,4]nonane.
| Compound Name | (1R,9S)-3,7,8,9-tetramethyl-2,5-dioxatricyclo[5.2.0.01,4]nonane |
|---|---|
| PubChem CID | 89076380 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1R,9S)-3,7,8,9-tetramethyl-2,5-dioxatricyclo[5.2.0.01,4]nonane |
| SMILES | CC1O[C@@]23C1OCC2(C)C(C)[C@@H]3C |
| InChI | InChI=1S/C11H18O2/c1-6-7(2)11-9(8(3)13-11)12-5-10(6,11)4/h6-9H,5H2,1-4H3/t6?,7-,8?,9?,10?,11-/m0/s1 |
| InChIKey | FQQCBFHJZYEQFV-LJYHQMAESA-N |
| XLogP | 1.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |