About 7-ethyl-2,5,9-trioxaspiro[3.5]nonane
7-ethyl-2,5,9-trioxaspiro[3.5]nonane (PubChem CID 89076501) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 7-ethyl-2,5,9-trioxaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-ethyl-2,5,9-trioxaspiro[3.5]nonane |
| PubChem CID | 89076501 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 7-ethyl-2,5,9-trioxaspiro[3.5]nonane |
| SMILES | CCC1COC2(COC2)OC1 |
| InChI | InChI=1S/C8H14O3/c1-2-7-3-10-8(11-4-7)5-9-6-8/h7H,2-6H2,1H3 |
| InChIKey | DRTQWNTXTOWEMJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethyl-2,5,9-trioxaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,5,9-trioxaspiro[3.5]nonane?
The IUPAC name of 7-ethyl-2,5,9-trioxaspiro[3.5]nonane (CID 89076501) is 7-ethyl-2,5,9-trioxaspiro[3.5]nonane.
What is the SMILES notation for 7-ethyl-2,5,9-trioxaspiro[3.5]nonane?
The canonical SMILES for 7-ethyl-2,5,9-trioxaspiro[3.5]nonane is CCC1COC2(COC2)OC1.
What is the InChIKey of 7-ethyl-2,5,9-trioxaspiro[3.5]nonane?
The InChIKey is DRTQWNTXTOWEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-7-3-10-8(11-4-7)5-9-6-8/h7H,2-6H2,1H3.
What are the key properties of 7-ethyl-2,5,9-trioxaspiro[3.5]nonane?
7-ethyl-2,5,9-trioxaspiro[3.5]nonane has a molecular weight of 158.20 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,5,9-trioxaspiro[3.5]nonane is sourced from PubChem (CID 89076501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).