About 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene
1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene (PubChem CID 89076598) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene |
| PubChem CID | 89076598 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene |
| SMILES | CCC1=CC(C)C(OO)C(C)C1 |
| InChI | InChI=1S/C10H18O2/c1-4-9-5-7(2)10(12-11)8(3)6-9/h5,7-8,10-11H,4,6H2,1-3H3 |
| InChIKey | BIIJKFGRMVKGCI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene?
The IUPAC name of 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene (CID 89076598) is 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene.
What is the SMILES notation for 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene?
The canonical SMILES for 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene is CCC1=CC(C)C(OO)C(C)C1.
What is the InChIKey of 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene?
The InChIKey is BIIJKFGRMVKGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-9-5-7(2)10(12-11)8(3)6-9/h5,7-8,10-11H,4,6H2,1-3H3.
What are the key properties of 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene?
1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene has a molecular weight of 170.25 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-hydroperoxy-3,5-dimethylcyclohexene is sourced from PubChem (CID 89076598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).