C21H28O3 — CID 89076844
(1S,5S,8R,9S,11S,13R,15R)-3-hydroxy-1,5,9-trimethyl-13-prop-1-en-2-yltetracyclo[6.5.2.04,15.011,15]pentadec-3-ene-2,14-dione (PubChem CID 89076844) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,5S,8R,9S,11S,13R,15R)-3-hydroxy-1,5,9-trimethyl-13-prop-1-en-2-yltetracyclo[6.5.2.04,15.011,15]pentadec-3-ene-2,14-dione.
| Compound Name | (1S,5S,8R,9S,11S,13R,15R)-3-hydroxy-1,5,9-trimethyl-13-prop-1-en-2-yltetracyclo[6.5.2.04,15.011,15]pentadec-3-ene-2,14-dione |
|---|---|
| PubChem CID | 89076844 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,5S,8R,9S,11S,13R,15R)-3-hydroxy-1,5,9-trimethyl-13-prop-1-en-2-yltetracyclo[6.5.2.04,15.011,15]pentadec-3-ene-2,14-dione |
| SMILES | C=C(C)[C@H]1C[C@@H]2C[C@H](C)[C@H]3CC[C@H](C)C4=C(O)C(=O)[C@]1(C)C(=O)[C@]423 |
| InChI | InChI=1S/C21H28O3/c1-10(2)15-9-13-8-12(4)14-7-6-11(3)16-17(22)18(23)20(15,5)19(24)21(13,14)16/h11-15,22H,1,6-9H2,2-5H3/t11-,12-,13-,14+,15+,20+,21+/m0/s1 |
| InChIKey | ZDNAPIROJCZPIU-GIYNEWSXSA-N |
| XLogP | 4.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|