About (11Z,14Z)-icosa-11,14-dien-2-imine
(11Z,14Z)-icosa-11,14-dien-2-imine (PubChem CID 89077215) has the molecular formula C20H37N
and a molecular weight of 291.52 g/mol. Its IUPAC name is (11Z,14Z)-icosa-11,14-dien-2-imine.
Molecular Properties
| Compound Name | (11Z,14Z)-icosa-11,14-dien-2-imine |
| PubChem CID | 89077215 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (11Z,14Z)-icosa-11,14-dien-2-imine |
| SMILES | [H]/N=C(\C)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C20H37N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21/h7-8,10-11,21H,3-6,9,12-19H2,1-2H3/b8-7-,11-10-,21-20+ |
| InChIKey | WLQXAWDECZWHPX-QXWMEOLXSA-N |
| XLogP | 7.23 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (11Z,14Z)-icosa-11,14-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z,14Z)-icosa-11,14-dien-2-imine?
The IUPAC name of (11Z,14Z)-icosa-11,14-dien-2-imine (CID 89077215) is (11Z,14Z)-icosa-11,14-dien-2-imine.
What is the SMILES notation for (11Z,14Z)-icosa-11,14-dien-2-imine?
The canonical SMILES for (11Z,14Z)-icosa-11,14-dien-2-imine is [H]/N=C(\C)CCCCCCCC/C=C\C/C=C\CCCCC.
What is the InChIKey of (11Z,14Z)-icosa-11,14-dien-2-imine?
The InChIKey is WLQXAWDECZWHPX-QXWMEOLXSA-N. The full InChI is InChI=1S/C20H37N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21/h7-8,10-11,21H,3-6,9,12-19H2,1-2H3/b8-7-,11-10-,21-20+.
What are the key properties of (11Z,14Z)-icosa-11,14-dien-2-imine?
(11Z,14Z)-icosa-11,14-dien-2-imine has a molecular weight of 291.52 g/mol, XLogP of 7.23, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z,14Z)-icosa-11,14-dien-2-imine is sourced from PubChem (CID 89077215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).