About 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile
1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile (PubChem CID 89077260) has the molecular formula C26H31N4OS+
and a molecular weight of 447.63 g/mol. Its IUPAC name is 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile.
Molecular Properties
| Compound Name | 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile |
| PubChem CID | 89077260 |
| Molecular Formula | C26H31N4OS+ |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile |
| SMILES | CCc1cc(=[N+]2CCC(C#N)CC2)cc2sc3cc(N4CCOCC4)cc(CC)c3nc1-2 |
| InChI | InChI=1S/C26H31N4OS/c1-3-19-13-21(29-7-5-18(17-27)6-8-29)15-23-25(19)28-26-20(4-2)14-22(16-24(26)32-23)30-9-11-31-12-10-30/h13-16,18H,3-12H2,1-2H3/q+1 |
| InChIKey | DVCKQMVWMBWIGZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile?
The IUPAC name of 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile (CID 89077260) is 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile.
What is the SMILES notation for 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile?
The canonical SMILES for 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile is CCc1cc(=[N+]2CCC(C#N)CC2)cc2sc3cc(N4CCOCC4)cc(CC)c3nc1-2.
What is the InChIKey of 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile?
The InChIKey is DVCKQMVWMBWIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N4OS/c1-3-19-13-21(29-7-5-18(17-27)6-8-29)15-23-25(19)28-26-20(4-2)14-22(16-24(26)32-23)30-9-11-31-12-10-30/h13-16,18H,3-12H2,1-2H3/q+1.
What are the key properties of 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile?
1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile has a molecular weight of 447.63 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-carbonitrile is sourced from PubChem (CID 89077260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).