C25H23Cl2N5O3S — CID 89077633
(5E)-5-[[2-[4-[[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077633) has the molecular formula C25H23Cl2N5O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077633 |
| Molecular Formula | C25H23Cl2N5O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | (5E)-5-[[2-[4-[[[5-(2,4-dichlorophenyl)furan-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CNCc4ccc(-c5ccc(Cl)cc5Cl)o4)CC3)n2)S1 |
| InChI | InChI=1S/C25H23Cl2N5O3S/c26-16-1-3-19(20(27)11-16)21-4-2-18(35-21)14-28-13-15-6-9-32(10-7-15)24-29-8-5-17(30-24)12-22-23(33)31-25(34)36-22/h1-5,8,11-12,15,28H,6-7,9-10,13-14H2,(H,31,33,34)/b22-12+ |
| InChIKey | SOWJIDVJKHSBDT-WSDLNYQXSA-N |
| XLogP | 5.37 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|