C26H50O8 — CID 89077663
2,2-bis[2-(2-butoxypropoxy)propyl]hexanedioic acid (PubChem CID 89077663) has the molecular formula C26H50O8 and a molecular weight of 490.68 g/mol. Its IUPAC name is 2,2-bis[2-(2-butoxypropoxy)propyl]hexanedioic acid.
| Compound Name | 2,2-bis[2-(2-butoxypropoxy)propyl]hexanedioic acid |
|---|---|
| PubChem CID | 89077663 |
| Molecular Formula | C26H50O8 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 2,2-bis[2-(2-butoxypropoxy)propyl]hexanedioic acid |
| SMILES | CCCCOC(C)COC(C)CC(CCCC(=O)O)(CC(C)OCC(C)OCCCC)C(=O)O |
| InChI | InChI=1S/C26H50O8/c1-7-9-14-31-22(5)18-33-20(3)16-26(25(29)30,13-11-12-24(27)28)17-21(4)34-19-23(6)32-15-10-8-2/h20-23H,7-19H2,1-6H3,(H,27,28)(H,29,30) |
| InChIKey | LTMNPHLVPOMWPW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|