C23H23N5O3S2 — CID 89077667
(5E)-5-[[2-[4-[[[4-(furan-2-yl)thiophen-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077667) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[[[4-(furan-2-yl)thiophen-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[[[4-(furan-2-yl)thiophen-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077667 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (5E)-5-[[2-[4-[[[4-(furan-2-yl)thiophen-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CNCc4cc(-c5ccco5)cs4)CC3)n2)S1 |
| InChI | InChI=1S/C23H23N5O3S2/c29-21-20(33-23(30)27-21)11-17-3-6-25-22(26-17)28-7-4-15(5-8-28)12-24-13-18-10-16(14-32-18)19-2-1-9-31-19/h1-3,6,9-11,14-15,24H,4-5,7-8,12-13H2,(H,27,29,30)/b20-11+ |
| InChIKey | LHZPVARJEGRWEP-RGVLZGJSSA-N |
| XLogP | 4.13 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|