About bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid
bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid (PubChem CID 89077786) has the molecular formula C14H8FNO2
and a molecular weight of 241.22 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid |
| PubChem CID | 89077786 |
| Molecular Formula | C14H8FNO2 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid |
| SMILES | C#Cc1ccnc(C(=O)O)c1F.c1cc2cc-2c1 |
| InChI | InChI=1S/C8H4FNO2.C6H4/c1-2-5-3-4-10-7(6(5)9)8(11)12;1-2-5-4-6(5)3-1/h1,3-4H,(H,11,12);1-4H |
| InChIKey | QCNFLVZVAHTJJG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid (CID 89077786) is bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid is C#Cc1ccnc(C(=O)O)c1F.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid?
The InChIKey is QCNFLVZVAHTJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO2.C6H4/c1-2-5-3-4-10-7(6(5)9)8(11)12;1-2-5-4-6(5)3-1/h1,3-4H,(H,11,12);1-4H.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid?
bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid has a molecular weight of 241.22 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-3-fluoropyridine-2-carboxylic acid is sourced from PubChem (CID 89077786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).