C27H26FN5O3S — CID 89077798
(5Z)-5-[[2-[2-[[4-fluoro-2-(furan-2-yl)phenyl]methylamino]-7-azaspiro[3.5]nonan-7-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077798) has the molecular formula C27H26FN5O3S and a molecular weight of 519.60 g/mol. Its IUPAC name is (5Z)-5-[[2-[2-[[4-fluoro-2-(furan-2-yl)phenyl]methylamino]-7-azaspiro[3.5]nonan-7-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[2-[[4-fluoro-2-(furan-2-yl)phenyl]methylamino]-7-azaspiro[3.5]nonan-7-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077798 |
| Molecular Formula | C27H26FN5O3S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | (5Z)-5-[[2-[2-[[4-fluoro-2-(furan-2-yl)phenyl]methylamino]-7-azaspiro[3.5]nonan-7-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3CCC4(CC3)CC(NCc3ccc(F)cc3-c3ccco3)C4)n2)S1 |
| InChI | InChI=1S/C27H26FN5O3S/c28-18-4-3-17(21(12-18)22-2-1-11-36-22)16-30-20-14-27(15-20)6-9-33(10-7-27)25-29-8-5-19(31-25)13-23-24(34)32-26(35)37-23/h1-5,8,11-13,20,30H,6-7,9-10,14-16H2,(H,32,34,35)/b23-13- |
| InChIKey | DXKHWERGJZUONZ-QRVIBDJDSA-N |
| XLogP | 4.74 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|