C24H24N6O3S — CID 89077841
(5E)-5-[[2-[4-[[[6-(furan-2-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077841) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[[[6-(furan-2-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[[[6-(furan-2-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077841 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (5E)-5-[[2-[4-[[[6-(furan-2-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CNCc4ccc(-c5ccco5)nc4)CC3)n2)S1 |
| InChI | InChI=1S/C24H24N6O3S/c31-22-21(34-24(32)29-22)12-18-5-8-26-23(28-18)30-9-6-16(7-10-30)13-25-14-17-3-4-19(27-15-17)20-2-1-11-33-20/h1-5,8,11-12,15-16,25H,6-7,9-10,13-14H2,(H,29,31,32)/b21-12+ |
| InChIKey | QYAAOYCIKZQZKE-CIAFOILYSA-N |
| XLogP | 3.46 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|