C31H40N2O6 — CID 89077951
(2R,4S,7S,14E)-7-tert-butyl-2,17-dimethoxy-12,12-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-4-carbaldehyde (PubChem CID 89077951) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is (2R,4S,7S,14E)-7-tert-butyl-2,17-dimethoxy-12,12-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-4-carbaldehyde.
| Compound Name | (2R,4S,7S,14E)-7-tert-butyl-2,17-dimethoxy-12,12-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 89077951 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (2R,4S,7S,14E)-7-tert-butyl-2,17-dimethoxy-12,12-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-4-carbaldehyde |
| SMILES | COc1cc2ccc3cc2cc1/C=C\CC(C)(C)COC(=O)N[C@@H](C(C)(C)C)C(=O)N1C[C@@]3(OC)C[C@H]1C=O |
| InChI | InChI=1S/C31H40N2O6/c1-29(2,3)26-27(35)33-18-31(38-7,16-24(33)17-34)23-11-10-20-15-25(37-6)21(13-22(20)14-23)9-8-12-30(4,5)19-39-28(36)32-26/h8-11,13-15,17,24,26H,12,16,18-19H2,1-7H3,(H,32,36)/b9-8-/t24-,26+,31-/m0/s1 |
| InChIKey | MWYDLFQQLAYDQZ-UXTFGNFCSA-N |
| XLogP | 5.07 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|