C33H46N2O4 — CID 89077974
N-[(2S)-1-[(2R,4R)-4-(7-ethenyl-6-methoxynaphthalen-2-yl)-4-methoxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]oct-7-enamide (PubChem CID 89077974) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is N-[(2S)-1-[(2R,4R)-4-(7-ethenyl-6-methoxynaphthalen-2-yl)-4-methoxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]oct-7-enamide.
| Compound Name | N-[(2S)-1-[(2R,4R)-4-(7-ethenyl-6-methoxynaphthalen-2-yl)-4-methoxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]oct-7-enamide |
|---|---|
| PubChem CID | 89077974 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | N-[(2S)-1-[(2R,4R)-4-(7-ethenyl-6-methoxynaphthalen-2-yl)-4-methoxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]oct-7-enamide |
| SMILES | C=CCCCCCC(=O)N[C@H](C(=O)N1C[C@](OC)(c2ccc3cc(OC)c(C=C)cc3c2)C[C@H]1C)C(C)(C)C |
| InChI | InChI=1S/C33H46N2O4/c1-9-11-12-13-14-15-29(36)34-30(32(4,5)6)31(37)35-22-33(39-8,21-23(35)3)27-17-16-25-20-28(38-7)24(10-2)18-26(25)19-27/h9-10,16-20,23,30H,1-2,11-15,21-22H2,3-8H3,(H,34,36)/t23-,30-,33+/m1/s1 |
| InChIKey | JOMDGZLUSSFWEG-JWOPOHGRSA-N |
| XLogP | 6.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|