C20H14BCl2N5O — CID 89078169
CID 89078169 (PubChem CID 89078169) has the molecular formula C20H14BCl2N5O and a molecular weight of 422.08 g/mol.
| Compound Name | CID 89078169 |
|---|---|
| PubChem CID | 89078169 |
| Molecular Formula | C20H14BCl2N5O |
| Molecular Weight | 422.08 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)c2cnc3c(c2)nc(Nc2c(Cl)cccc2Cl)n3C)cc1 |
| InChI | InChI=1S/C20H14BCl2N5O/c1-28-18-16(26-20(28)27-17-14(22)3-2-4-15(17)23)9-11(10-24-18)19(29)25-13-7-5-12(21)6-8-13/h2-10H,1H3,(H,25,29)(H,26,27) |
| InChIKey | FQDSUWUKDBHRTD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|