About 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate
2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate (PubChem CID 89078178) has the molecular formula C12H21F3O4S
and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate |
| PubChem CID | 89078178 |
| Molecular Formula | C12H21F3O4S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate |
| SMILES | CC(C)COC(=O)C(C)(C)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H21F3O4S/c1-9(2)8-19-10(16)11(3,4)20(17,18)7-5-6-12(13,14)15/h9H,5-8H2,1-4H3 |
| InChIKey | VWHJNOVWCGPMMK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate?
The IUPAC name of 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate (CID 89078178) is 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate.
What is the SMILES notation for 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate?
The canonical SMILES for 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate is CC(C)COC(=O)C(C)(C)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate?
The InChIKey is VWHJNOVWCGPMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3O4S/c1-9(2)8-19-10(16)11(3,4)20(17,18)7-5-6-12(13,14)15/h9H,5-8H2,1-4H3.
What are the key properties of 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate?
2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate has a molecular weight of 318.36 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate is sourced from PubChem (CID 89078178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).