C7H14OS — CID 89078243
[(2S,4S,5S)-4,5-dimethylthiolan-2-yl]methanol (PubChem CID 89078243) has the molecular formula C7H14OS and a molecular weight of 146.25 g/mol. Its IUPAC name is [(2S,4S,5S)-4,5-dimethylthiolan-2-yl]methanol.
| Compound Name | [(2S,4S,5S)-4,5-dimethylthiolan-2-yl]methanol |
|---|---|
| PubChem CID | 89078243 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | [(2S,4S,5S)-4,5-dimethylthiolan-2-yl]methanol |
| SMILES | C[C@@H]1S[C@H](CO)C[C@@H]1C |
| InChI | InChI=1S/C7H14OS/c1-5-3-7(4-8)9-6(5)2/h5-8H,3-4H2,1-2H3/t5-,6-,7-/m0/s1 |
| InChIKey | XJLYQIWQGVLAPE-ACZMJKKPSA-N |
| XLogP | 1.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |