C7H14O2S — CID 89078267
(2S,3R,5S)-5-(hydroxymethyl)-2,3-dimethylthiolan-3-ol (PubChem CID 89078267) has the molecular formula C7H14O2S and a molecular weight of 162.25 g/mol. Its IUPAC name is (2S,3R,5S)-5-(hydroxymethyl)-2,3-dimethylthiolan-3-ol.
| Compound Name | (2S,3R,5S)-5-(hydroxymethyl)-2,3-dimethylthiolan-3-ol |
|---|---|
| PubChem CID | 89078267 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (2S,3R,5S)-5-(hydroxymethyl)-2,3-dimethylthiolan-3-ol |
| SMILES | C[C@@H]1S[C@H](CO)C[C@@]1(C)O |
| InChI | InChI=1S/C7H14O2S/c1-5-7(2,9)3-6(4-8)10-5/h5-6,8-9H,3-4H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | YYAVOZIXSWHOJN-LYFYHCNISA-N |
| XLogP | 0.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |