About [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol
[(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol (PubChem CID 89078315) has the molecular formula C8H13F3O
and a molecular weight of 182.18 g/mol. Its IUPAC name is [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol |
| PubChem CID | 89078315 |
| Molecular Formula | C8H13F3O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol |
| SMILES | C[C@@H]1C[C@H](CO)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C8H13F3O/c1-5-2-6(4-12)3-7(5)8(9,10)11/h5-7,12H,2-4H2,1H3/t5-,6+,7+/m1/s1 |
| InChIKey | RFYKXDBQJUAGDM-VQVTYTSYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol?
The IUPAC name of [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol (CID 89078315) is [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol.
What is the SMILES notation for [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol?
The canonical SMILES for [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol is C[C@@H]1C[C@H](CO)C[C@@H]1C(F)(F)F.
What is the InChIKey of [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol?
The InChIKey is RFYKXDBQJUAGDM-VQVTYTSYSA-N. The full InChI is InChI=1S/C8H13F3O/c1-5-2-6(4-12)3-7(5)8(9,10)11/h5-7,12H,2-4H2,1H3/t5-,6+,7+/m1/s1.
What are the key properties of [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol?
[(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol has a molecular weight of 182.18 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R,4S)-3-methyl-4-(trifluoromethyl)cyclopentyl]methanol is sourced from PubChem (CID 89078315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).