About [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol
[(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol (PubChem CID 89078319) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol |
| PubChem CID | 89078319 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol |
| SMILES | C[C@@H]1N[C@H](CO)C[C@@H]1CF |
| InChI | InChI=1S/C7H14FNO/c1-5-6(3-8)2-7(4-10)9-5/h5-7,9-10H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | MDDYONAVGLBQHZ-XVMARJQXSA-N |
| XLogP | 0.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol (CID 89078319) is [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol is C[C@@H]1N[C@H](CO)C[C@@H]1CF.
What is the InChIKey of [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol?
The InChIKey is MDDYONAVGLBQHZ-XVMARJQXSA-N. The full InChI is InChI=1S/C7H14FNO/c1-5-6(3-8)2-7(4-10)9-5/h5-7,9-10H,2-4H2,1H3/t5-,6+,7-/m0/s1.
What are the key properties of [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol?
[(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol has a molecular weight of 147.19 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S,5S)-4-(fluoromethyl)-5-methylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 89078319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).