C29H31ClN4O3 — CID 89078519
N-benzhydryl-1-[2-[2-(chloroamino)propanoylamino]-2-phenylacetyl]pyrrolidine-2-carboxamide (PubChem CID 89078519) has the molecular formula C29H31ClN4O3 and a molecular weight of 519.05 g/mol. Its IUPAC name is N-benzhydryl-1-[2-[2-(chloroamino)propanoylamino]-2-phenylacetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-benzhydryl-1-[2-[2-(chloroamino)propanoylamino]-2-phenylacetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89078519 |
| Molecular Formula | C29H31ClN4O3 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | N-benzhydryl-1-[2-[2-(chloroamino)propanoylamino]-2-phenylacetyl]pyrrolidine-2-carboxamide |
| SMILES | CC(NCl)C(=O)NC(C(=O)N1CCCC1C(=O)NC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31ClN4O3/c1-20(33-30)27(35)32-26(23-16-9-4-10-17-23)29(37)34-19-11-18-24(34)28(36)31-25(21-12-5-2-6-13-21)22-14-7-3-8-15-22/h2-10,12-17,20,24-26,33H,11,18-19H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | OZHRGKAHGQKHSO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|