About naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate
naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 890786) has the molecular formula C21H15NO4
and a molecular weight of 345.35 g/mol. Its IUPAC name is naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 890786 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H15NO4/c23-19(26-16-10-9-14-5-1-2-6-15(14)13-16)11-12-22-20(24)17-7-3-4-8-18(17)21(22)25/h1-10,13H,11-12H2 |
| InChIKey | NSJHGQZIEWRJIZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate (CID 890786) is naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate is O=C(CCN1C(=O)c2ccccc2C1=O)Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is NSJHGQZIEWRJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO4/c23-19(26-16-10-9-14-5-1-2-6-15(14)13-16)11-12-22-20(24)17-7-3-4-8-18(17)21(22)25/h1-10,13H,11-12H2.
What are the key properties of naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate?
naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 345.35 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl 3-(1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 890786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).