About (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine
(Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine (PubChem CID 89078690) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine |
| PubChem CID | 89078690 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine |
| SMILES | CC/C=C\C(CCNC(C)(C)CC)NC(C)(C)CC |
| InChI | InChI=1S/C17H36N2/c1-8-11-12-15(19-17(6,7)10-3)13-14-18-16(4,5)9-2/h11-12,15,18-19H,8-10,13-14H2,1-7H3/b12-11- |
| InChIKey | KAXOXTLDXDDSOW-QXMHVHEDSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine?
The IUPAC name of (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine (CID 89078690) is (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine.
What is the SMILES notation for (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine?
The canonical SMILES for (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine is CC/C=C\C(CCNC(C)(C)CC)NC(C)(C)CC.
What is the InChIKey of (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine?
The InChIKey is KAXOXTLDXDDSOW-QXMHVHEDSA-N. The full InChI is InChI=1S/C17H36N2/c1-8-11-12-15(19-17(6,7)10-3)13-14-18-16(4,5)9-2/h11-12,15,18-19H,8-10,13-14H2,1-7H3/b12-11-.
What are the key properties of (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine?
(Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine has a molecular weight of 268.49 g/mol, XLogP of 4.27, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N,3-N-bis(2-methylbutan-2-yl)hept-4-ene-1,3-diamine is sourced from PubChem (CID 89078690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).