About 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline
3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline (PubChem CID 89078711) has the molecular formula C17H22ClN4+
and a molecular weight of 317.84 g/mol. Its IUPAC name is 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline |
| PubChem CID | 89078711 |
| Molecular Formula | C17H22ClN4+ |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(C)c[n+]2C)c(Cl)c1 |
| InChI | InChI=1S/C17H22ClN4/c1-5-22(6-2)14-8-9-16(15(18)11-14)19-20-17-10-7-13(3)12-21(17)4/h7-12H,5-6H2,1-4H3/q+1 |
| InChIKey | CDZVMQCJWUUSNY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline?
The IUPAC name of 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline (CID 89078711) is 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline.
What is the SMILES notation for 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline?
The canonical SMILES for 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline is CCN(CC)c1ccc(/N=N/c2ccc(C)c[n+]2C)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline?
The InChIKey is CDZVMQCJWUUSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN4/c1-5-22(6-2)14-8-9-16(15(18)11-14)19-20-17-10-7-13(3)12-21(17)4/h7-12H,5-6H2,1-4H3/q+1.
What are the key properties of 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline?
3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline has a molecular weight of 317.84 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-N,N-diethylaniline is sourced from PubChem (CID 89078711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).