C40H35F3N4O3S — CID 89079052
1-[4-[(E)-2-[5-[(E)-2-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]ethenyl]thiophen-2-yl]ethenyl]-N-ethylanilino]pentyl 4-(1,2,2-trifluoroethenyl)benzoate (PubChem CID 89079052) has the molecular formula C40H35F3N4O3S and a molecular weight of 708.81 g/mol. Its IUPAC name is 1-[4-[(E)-2-[5-[(E)-2-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]ethenyl]thiophen-2-yl]ethenyl]-N-ethylanilino]pentyl 4-(1,2,2-trifluoroethenyl)benzoate.
| Compound Name | 1-[4-[(E)-2-[5-[(E)-2-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]ethenyl]thiophen-2-yl]ethenyl]-N-ethylanilino]pentyl 4-(1,2,2-trifluoroethenyl)benzoate |
|---|---|
| PubChem CID | 89079052 |
| Molecular Formula | C40H35F3N4O3S |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.24 |
| IUPAC Name | 1-[4-[(E)-2-[5-[(E)-2-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]ethenyl]thiophen-2-yl]ethenyl]-N-ethylanilino]pentyl 4-(1,2,2-trifluoroethenyl)benzoate |
| SMILES | CCCCC(OC(=O)c1ccc(C(F)=C(F)F)cc1)N(CC)c1ccc(/C=C/c2ccc(/C=C/C3=C(C#N)C(=C(C#N)C#N)OC3(C)C)s2)cc1 |
| InChI | InChI=1S/C40H35F3N4O3S/c1-5-7-8-35(49-39(48)28-14-12-27(13-15-28)36(41)38(42)43)47(6-2)30-16-9-26(10-17-30)11-18-31-19-20-32(51-31)21-22-34-33(25-46)37(29(23-44)24-45)50-40(34,3)4/h9-22,35H,5-8H2,1-4H3/b18-11+,22-21+ |
| InChIKey | KNSWNLRMBYCZMH-FYQLEFRXSA-N |
| XLogP | 10.60 |
| TPSA | 110.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|