C19H31BN2O3 — CID 89079146
2-amino-1-[2-[(6S)-6,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]dec-1(9)-en-4-yl]pyrrolidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 89079146) has the molecular formula C19H31BN2O3 and a molecular weight of 346.28 g/mol. Its IUPAC name is 2-amino-1-[2-[(6S)-6,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]dec-1(9)-en-4-yl]pyrrolidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 2-amino-1-[2-[(6S)-6,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]dec-1(9)-en-4-yl]pyrrolidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 89079146 |
| Molecular Formula | C19H31BN2O3 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-amino-1-[2-[(6S)-6,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]dec-1(9)-en-4-yl]pyrrolidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC1=C2CC1C[C@]1(C)OB(C3CCCN3C(=O)C(N)C(C)(C)C)OC21 |
| InChI | InChI=1S/C19H31BN2O3/c1-11-12-9-13(11)16-19(5,10-12)25-20(24-16)14-7-6-8-22(14)17(23)15(21)18(2,3)4/h12,14-16H,6-10,21H2,1-5H3/t12?,14?,15?,16?,19-/m0/s1 |
| InChIKey | QSTLCXHDLLCCJP-UBEICAPYSA-N |
| XLogP | 2.29 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|