C21H38INO5Si — CID 89079328
2-trimethylsilylethyl (2R,3S,4R)-2-[(S)-cyclohexyl(hydroxy)methyl]-3-hydroxy-3-(iodomethyl)-5-oxo-4-propylpyrrolidine-2-carboxylate (PubChem CID 89079328) has the molecular formula C21H38INO5Si and a molecular weight of 539.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R,3S,4R)-2-[(S)-cyclohexyl(hydroxy)methyl]-3-hydroxy-3-(iodomethyl)-5-oxo-4-propylpyrrolidine-2-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2R,3S,4R)-2-[(S)-cyclohexyl(hydroxy)methyl]-3-hydroxy-3-(iodomethyl)-5-oxo-4-propylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 89079328 |
| Molecular Formula | C21H38INO5Si |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-trimethylsilylethyl (2R,3S,4R)-2-[(S)-cyclohexyl(hydroxy)methyl]-3-hydroxy-3-(iodomethyl)-5-oxo-4-propylpyrrolidine-2-carboxylate |
| SMILES | CCC[C@H]1C(=O)N[C@](C(=O)OCC[Si](C)(C)C)([C@@H](O)C2CCCCC2)[C@]1(O)CI |
| InChI | InChI=1S/C21H38INO5Si/c1-5-9-16-18(25)23-21(20(16,27)14-22,17(24)15-10-7-6-8-11-15)19(26)28-12-13-29(2,3)4/h15-17,24,27H,5-14H2,1-4H3,(H,23,25)/t16-,17-,20-,21-/m0/s1 |
| InChIKey | ABWOAOUFRSGTTP-USNOLKROSA-N |
| XLogP | 3.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|