C19H25Cl2NO — CID 89079346
17-chloro-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 89079346) has the molecular formula C19H25Cl2NO and a molecular weight of 354.32 g/mol. Its IUPAC name is 17-chloro-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | 17-chloro-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 89079346 |
| Molecular Formula | C19H25Cl2NO |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 17-chloro-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | ClCCCOc1ccc2c(c1)C13CCCCC1C(C2)N(Cl)CC3 |
| InChI | InChI=1S/C19H25Cl2NO/c20-9-3-11-23-15-6-5-14-12-18-16-4-1-2-7-19(16,17(14)13-15)8-10-22(18)21/h5-6,13,16,18H,1-4,7-12H2 |
| InChIKey | HPZNTHWQJCGMHY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|