About 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine]
5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] (PubChem CID 89079693) has the molecular formula C20H21ClFNO2
and a molecular weight of 361.84 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine].
Molecular Properties
| Compound Name | 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] |
| PubChem CID | 89079693 |
| Molecular Formula | C20H21ClFNO2 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] |
| SMILES | CCCCCN1OCC2(COc3cc(F)c(Cl)cc32)c2ccccc21 |
| InChI | InChI=1S/C20H21ClFNO2/c1-2-3-6-9-23-18-8-5-4-7-14(18)20(13-25-23)12-24-19-11-17(22)16(21)10-15(19)20/h4-5,7-8,10-11H,2-3,6,9,12-13H2,1H3 |
| InChIKey | INYQLLCSZWNKRG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine]?
The IUPAC name of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] (CID 89079693) is 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine].
What is the SMILES notation for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine]?
The canonical SMILES for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] is CCCCCN1OCC2(COc3cc(F)c(Cl)cc32)c2ccccc21.
What is the InChIKey of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine]?
The InChIKey is INYQLLCSZWNKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClFNO2/c1-2-3-6-9-23-18-8-5-4-7-14(18)20(13-25-23)12-24-19-11-17(22)16(21)10-15(19)20/h4-5,7-8,10-11H,2-3,6,9,12-13H2,1H3.
What are the key properties of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine]?
5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] has a molecular weight of 361.84 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,4'-3H-2,1-benzoxazine] is sourced from PubChem (CID 89079693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).