C12H13NO4S — CID 89079856
7-acetyloxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylic acid (PubChem CID 89079856) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 7-acetyloxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylic acid.
| Compound Name | 7-acetyloxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 89079856 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 7-acetyloxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2c(c1)CN(C(=O)O)CCS2 |
| InChI | InChI=1S/C12H13NO4S/c1-8(14)17-10-2-3-11-9(6-10)7-13(12(15)16)4-5-18-11/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | KVLRJGWFFRUNMN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|