C21H26Cl2N6O3 — CID 89080404
[(3S)-1-[N-cyano-N'-[(2R)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]propyl]carbamimidoyl]pyrrolidin-3-yl] acetate (PubChem CID 89080404) has the molecular formula C21H26Cl2N6O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is [(3S)-1-[N-cyano-N'-[(2R)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]propyl]carbamimidoyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3S)-1-[N-cyano-N'-[(2R)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]propyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 89080404 |
| Molecular Formula | C21H26Cl2N6O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [(3S)-1-[N-cyano-N'-[(2R)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]propyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN(/C(=N/C[C@@H](C)NC(=O)c2c(Cl)cc3c(c2Cl)CCNC3)NC#N)C1 |
| InChI | InChI=1S/C21H26Cl2N6O3/c1-12(8-26-21(27-11-24)29-6-4-15(10-29)32-13(2)30)28-20(31)18-17(22)7-14-9-25-5-3-16(14)19(18)23/h7,12,15,25H,3-6,8-10H2,1-2H3,(H,26,27)(H,28,31)/t12-,15+/m1/s1 |
| InChIKey | XHLCVTSEBROPLL-DOMZBBRYSA-N |
| XLogP | 1.82 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|