C17H20N2O2 — CID 89080439
[(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 6-deuterio-1H-indole-3-carboxylate (PubChem CID 89080439) has the molecular formula C17H20N2O2 and a molecular weight of 285.37 g/mol. Its IUPAC name is [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 6-deuterio-1H-indole-3-carboxylate.
| Compound Name | [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 6-deuterio-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 89080439 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | [(5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 6-deuterio-1H-indole-3-carboxylate |
| SMILES | [2H]c1ccc2c(C(=O)OC3CC4CC[C@H](C3)N4C)c[nH]c2c1 |
| InChI | InChI=1S/C17H20N2O2/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16/h2-5,10-13,18H,6-9H2,1H3/t11-,12?,13?/m1/s1/i3D |
| InChIKey | ZNRGQMMCGHDTEI-SWAGNYSQSA-N |
| XLogP | 2.95 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |