C17H25FO6S — CID 89081049
[(2S,3R,4R,5R)-5-(butoxymethyl)-4-fluoro-2-methoxyoxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 89081049) has the molecular formula C17H25FO6S and a molecular weight of 376.45 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-(butoxymethyl)-4-fluoro-2-methoxyoxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4R,5R)-5-(butoxymethyl)-4-fluoro-2-methoxyoxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89081049 |
| Molecular Formula | C17H25FO6S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [(2S,3R,4R,5R)-5-(butoxymethyl)-4-fluoro-2-methoxyoxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCOC[C@H]1O[C@H](OC)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1F |
| InChI | InChI=1S/C17H25FO6S/c1-4-5-10-22-11-14-15(18)16(17(21-3)23-14)24-25(19,20)13-8-6-12(2)7-9-13/h6-9,14-17H,4-5,10-11H2,1-3H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | RJMLPORNGGLYJQ-NCOADZHNSA-N |
| XLogP | 2.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|