C14H20N2O8 — CID 89081388
2-[[4-[3-(dihydroxyamino)oxypropyl]phenoxy]carbonylamino]-3-hydroxybutanoic acid (PubChem CID 89081388) has the molecular formula C14H20N2O8 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[[4-[3-(dihydroxyamino)oxypropyl]phenoxy]carbonylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[4-[3-(dihydroxyamino)oxypropyl]phenoxy]carbonylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 89081388 |
| Molecular Formula | C14H20N2O8 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[4-[3-(dihydroxyamino)oxypropyl]phenoxy]carbonylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)Oc1ccc(CCCON(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O8/c1-9(17)12(13(18)19)15-14(20)24-11-6-4-10(5-7-11)3-2-8-23-16(21)22/h4-7,9,12,17,21-22H,2-3,8H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | KGEPJUAFAQKPSZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|