About 3-methyl-2,5-dimethylidenethiophene
3-methyl-2,5-dimethylidenethiophene (PubChem CID 89082146) has the molecular formula C7H8S
and a molecular weight of 124.21 g/mol. Its IUPAC name is 3-methyl-2,5-dimethylidenethiophene.
Molecular Properties
| Compound Name | 3-methyl-2,5-dimethylidenethiophene |
| PubChem CID | 89082146 |
| Molecular Formula | C7H8S |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3-methyl-2,5-dimethylidenethiophene |
| SMILES | C=c1cc(C)c(=C)s1 |
| InChI | InChI=1S/C7H8S/c1-5-4-6(2)8-7(5)3/h4H,2-3H2,1H3 |
| InChIKey | VWLXIXDKNJTGHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-2,5-dimethylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,5-dimethylidenethiophene?
The IUPAC name of 3-methyl-2,5-dimethylidenethiophene (CID 89082146) is 3-methyl-2,5-dimethylidenethiophene.
What is the SMILES notation for 3-methyl-2,5-dimethylidenethiophene?
The canonical SMILES for 3-methyl-2,5-dimethylidenethiophene is C=c1cc(C)c(=C)s1.
What is the InChIKey of 3-methyl-2,5-dimethylidenethiophene?
The InChIKey is VWLXIXDKNJTGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S/c1-5-4-6(2)8-7(5)3/h4H,2-3H2,1H3.
What are the key properties of 3-methyl-2,5-dimethylidenethiophene?
3-methyl-2,5-dimethylidenethiophene has a molecular weight of 124.21 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,5-dimethylidenethiophene is sourced from PubChem (CID 89082146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).