C18H15F3N8O — CID 89082242
6-N-[3-amino-4-(trifluoromethoxy)phenyl]-8-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 89082242) has the molecular formula C18H15F3N8O and a molecular weight of 416.37 g/mol. Its IUPAC name is 6-N-[3-amino-4-(trifluoromethoxy)phenyl]-8-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 6-N-[3-amino-4-(trifluoromethoxy)phenyl]-8-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 89082242 |
| Molecular Formula | C18H15F3N8O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6-N-[3-amino-4-(trifluoromethoxy)phenyl]-8-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | Nc1cc(Nc2cc(Nc3ccccn3)c3ncc(N)n3n2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C18H15F3N8O/c19-18(20,21)30-13-5-4-10(7-11(13)22)26-16-8-12(27-15-3-1-2-6-24-15)17-25-9-14(23)29(17)28-16/h1-9H,22-23H2,(H,24,27)(H,26,28) |
| InChIKey | KZSSHMKVCGHHSB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|