About 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one
2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one (PubChem CID 89082670) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one.
Molecular Properties
| Compound Name | 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one |
| PubChem CID | 89082670 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one |
| SMILES | CCc1ncc2c(n1)NC(=O)CS2 |
| InChI | InChI=1S/C8H9N3OS/c1-2-6-9-3-5-8(10-6)11-7(12)4-13-5/h3H,2,4H2,1H3,(H,9,10,11,12) |
| InChIKey | SRPPPGUHJBCHNX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one?
The IUPAC name of 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one (CID 89082670) is 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one.
What is the SMILES notation for 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one?
The canonical SMILES for 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one is CCc1ncc2c(n1)NC(=O)CS2.
What is the InChIKey of 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one?
The InChIKey is SRPPPGUHJBCHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-2-6-9-3-5-8(10-6)11-7(12)4-13-5/h3H,2,4H2,1H3,(H,9,10,11,12).
What are the key properties of 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one?
2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one has a molecular weight of 195.25 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-8H-pyrimido[5,4-b][1,4]thiazin-7-one is sourced from PubChem (CID 89082670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).