C46H34IN3 — CID 89083605
(1Z,3E)-4-N-[4-(2,4-diphenyltriphenylen-1-yl)phenyl]-5-iodo-4-N-pyridin-2-ylpenta-1,3-diene-1,4-diamine (PubChem CID 89083605) has the molecular formula C46H34IN3 and a molecular weight of 755.70 g/mol. Its IUPAC name is (1Z,3E)-4-N-[4-(2,4-diphenyltriphenylen-1-yl)phenyl]-5-iodo-4-N-pyridin-2-ylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-4-N-[4-(2,4-diphenyltriphenylen-1-yl)phenyl]-5-iodo-4-N-pyridin-2-ylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 89083605 |
| Molecular Formula | C46H34IN3 |
| Molecular Weight | 755.70 g/mol |
| Exact Mass | 755.18 |
| IUPAC Name | (1Z,3E)-4-N-[4-(2,4-diphenyltriphenylen-1-yl)phenyl]-5-iodo-4-N-pyridin-2-ylpenta-1,3-diene-1,4-diamine |
| SMILES | N/C=C\C=C(/CI)N(c1ccc(-c2c(-c3ccccc3)cc(-c3ccccc3)c3c4ccccc4c4ccccc4c23)cc1)c1ccccn1 |
| InChI | InChI=1S/C46H34IN3/c47-31-36(18-13-28-48)50(43-23-11-12-29-49-43)35-26-24-34(25-27-35)44-41(32-14-3-1-4-15-32)30-42(33-16-5-2-6-17-33)45-39-21-9-7-19-37(39)38-20-8-10-22-40(38)46(44)45/h1-30H,31,48H2/b28-13-,36-18+ |
| InChIKey | XRJSEBLAFZXKLJ-ABQZGAHISA-N |
| XLogP | 12.47 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.70 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|