C65H57I — CID 89083902
6,10-bis(9,9-dimethylfluoren-2-yl)-9-[2-(5-iodo-9,9-dimethyl-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)phenyl]-2,3-dihydroanthracene (PubChem CID 89083902) has the molecular formula C65H57I and a molecular weight of 965.07 g/mol. Its IUPAC name is 6,10-bis(9,9-dimethylfluoren-2-yl)-9-[2-(5-iodo-9,9-dimethyl-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)phenyl]-2,3-dihydroanthracene.
| Compound Name | 6,10-bis(9,9-dimethylfluoren-2-yl)-9-[2-(5-iodo-9,9-dimethyl-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)phenyl]-2,3-dihydroanthracene |
|---|---|
| PubChem CID | 89083902 |
| Molecular Formula | C65H57I |
| Molecular Weight | 965.07 g/mol |
| Exact Mass | 964.35 |
| IUPAC Name | 6,10-bis(9,9-dimethylfluoren-2-yl)-9-[2-(5-iodo-9,9-dimethyl-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)phenyl]-2,3-dihydroanthracene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(-c5ccccc5-c5ccc6c(c5)C(C)(C)C5CCCC(I)C65)c5c(c(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)c4c3)=CCCC=5)cc21 |
| InChI | InChI=1S/C65H57I/c1-63(2)53-22-13-11-17-43(53)45-30-26-39(35-56(45)63)38-27-32-50-52(34-38)60(41-29-31-46-44-18-12-14-23-54(44)64(3,4)57(46)37-41)48-20-9-10-21-49(48)61(50)47-19-8-7-16-42(47)40-28-33-51-58(36-40)65(5,6)55-24-15-25-59(66)62(51)55/h7-8,11-14,16-23,26-37,55,59,62H,9-10,15,24-25H2,1-6H3 |
| InChIKey | HYPJTBIJJYFMFB-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.07 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|